C13H18N4O2S2 — CID 17449523
2-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione (PubChem CID 17449523) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 2-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione.
| Compound Name | 2-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
|---|---|
| PubChem CID | 17449523 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 2-[[(1,1-dioxothiolan-3-yl)-ethylamino]methyl]-[1,2,4]triazolo[4,3-a]pyridine-3-thione |
| SMILES | CCN(Cn1nc2ccccn2c1=S)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-2-15(11-6-8-21(18,19)9-11)10-17-13(20)16-7-4-3-5-12(16)14-17/h3-5,7,11H,2,6,8-10H2,1H3 |
| InChIKey | NIAFFXZMJOBMQF-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|