C15H9F6NO — CID 17449540
N-(2-fluoro-5-methylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide (PubChem CID 17449540) has the molecular formula C15H9F6NO and a molecular weight of 333.23 g/mol. Its IUPAC name is N-(2-fluoro-5-methylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide.
| Compound Name | N-(2-fluoro-5-methylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
|---|---|
| PubChem CID | 17449540 |
| Molecular Formula | C15H9F6NO |
| Molecular Weight | 333.23 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-(2-fluoro-5-methylphenyl)-2-(2,3,4,5,6-pentafluorophenyl)acetamide |
| SMILES | Cc1ccc(F)c(NC(=O)Cc2c(F)c(F)c(F)c(F)c2F)c1 |
| InChI | InChI=1S/C15H9F6NO/c1-6-2-3-8(16)9(4-6)22-10(23)5-7-11(17)13(19)15(21)14(20)12(7)18/h2-4H,5H2,1H3,(H,22,23) |
| InChIKey | SQSMEDUZEHIEGH-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.23 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|