About [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid
[6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid (PubChem CID 174495512) has the molecular formula C9H11BO5
and a molecular weight of 209.99 g/mol. Its IUPAC name is [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid.
Molecular Properties
| Compound Name | [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid |
| PubChem CID | 174495512 |
| Molecular Formula | C9H11BO5 |
| Molecular Weight | 209.99 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid |
| SMILES | CCOC1C(=C=O)C=CC=C1OB(O)O |
| InChI | InChI=1S/C9H11BO5/c1-2-14-9-7(6-11)4-3-5-8(9)15-10(12)13/h3-5,9,12-13H,2H2,1H3 |
| InChIKey | XHOYLFQBCNMWHB-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.99 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid?
The IUPAC name of [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid (CID 174495512) is [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid.
What is the SMILES notation for [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid?
The canonical SMILES for [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid is CCOC1C(=C=O)C=CC=C1OB(O)O.
What is the InChIKey of [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid?
The InChIKey is XHOYLFQBCNMWHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11BO5/c1-2-14-9-7(6-11)4-3-5-8(9)15-10(12)13/h3-5,9,12-13H,2H2,1H3.
What are the key properties of [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid?
[6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid has a molecular weight of 209.99 g/mol, XLogP of -0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-ethoxy-5-(oxomethylidene)cyclohexa-1,3-dien-1-yl]oxyboronic acid is sourced from PubChem (CID 174495512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).