About 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine
2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine (PubChem CID 174495647) has the molecular formula C21H35N3
and a molecular weight of 329.53 g/mol. Its IUPAC name is 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 174495647 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine |
| SMILES | CCCCC(CCCC)(CCCC)CCc1nc2ncccc2[nH]1 |
| InChI | InChI=1S/C21H35N3/c1-4-7-13-21(14-8-5-2,15-9-6-3)16-12-19-23-18-11-10-17-22-20(18)24-19/h10-11,17H,4-9,12-16H2,1-3H3,(H,22,23,24) |
| InChIKey | AZVUFOIYWFVZHI-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine (CID 174495647) is 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine is CCCCC(CCCC)(CCCC)CCc1nc2ncccc2[nH]1.
What is the InChIKey of 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine?
The InChIKey is AZVUFOIYWFVZHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H35N3/c1-4-7-13-21(14-8-5-2,15-9-6-3)16-12-19-23-18-11-10-17-22-20(18)24-19/h10-11,17H,4-9,12-16H2,1-3H3,(H,22,23,24).
What are the key properties of 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine?
2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine has a molecular weight of 329.53 g/mol, XLogP of 6.45, 12 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dibutylheptyl)-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 174495647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).