C8H14N4 — CID 174495716
2-N,3-N,6-N-trimethylpyridine-2,3,6-triamine (PubChem CID 174495716) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 2-N,3-N,6-N-trimethylpyridine-2,3,6-triamine.
| Compound Name | 2-N,3-N,6-N-trimethylpyridine-2,3,6-triamine |
|---|---|
| PubChem CID | 174495716 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 2-N,3-N,6-N-trimethylpyridine-2,3,6-triamine |
| SMILES | CNc1ccc(NC)c(NC)n1 |
| InChI | InChI=1S/C8H14N4/c1-9-6-4-5-7(10-2)12-8(6)11-3/h4-5,9H,1-3H3,(H2,10,11,12) |
| InChIKey | HJCDWMSXSMNLAM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |