C11H22N4O2 — CID 174496093
2-amino-4-methylpentanoic acid;2-(1H-imidazol-5-yl)ethanamine (PubChem CID 174496093) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-amino-4-methylpentanoic acid;2-(1H-imidazol-5-yl)ethanamine.
| Compound Name | 2-amino-4-methylpentanoic acid;2-(1H-imidazol-5-yl)ethanamine |
|---|---|
| PubChem CID | 174496093 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 2-amino-4-methylpentanoic acid;2-(1H-imidazol-5-yl)ethanamine |
| SMILES | CC(C)CC(N)C(=O)O.NCCc1cnc[nH]1 |
| InChI | InChI=1S/C6H13NO2.C5H9N3/c1-4(2)3-5(7)6(8)9;6-2-1-5-3-7-4-8-5/h4-5H,3,7H2,1-2H3,(H,8,9);3-4H,1-2,6H2,(H,7,8) |
| InChIKey | BVFQBLAQRAGJCU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 118.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |