About potassium methyl 2H-pyridin-2-ide-5-carboxylate
potassium methyl 2H-pyridin-2-ide-5-carboxylate (PubChem CID 174496363) has the molecular formula C7H6KNO2
and a molecular weight of 175.23 g/mol. Its IUPAC name is potassium methyl 2H-pyridin-2-ide-5-carboxylate.
Molecular Properties
| Compound Name | potassium methyl 2H-pyridin-2-ide-5-carboxylate |
| PubChem CID | 174496363 |
| Molecular Formula | C7H6KNO2 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | potassium methyl 2H-pyridin-2-ide-5-carboxylate |
| SMILES | COC(=O)c1cc[c-]nc1.[K+] |
| InChI | InChI=1S/C7H6NO2.K/c1-10-7(9)6-3-2-4-8-5-6;/h2-3,5H,1H3;/q-1;+1 |
| InChIKey | JFSHJUMSXKKSQV-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium methyl 2H-pyridin-2-ide-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium methyl 2H-pyridin-2-ide-5-carboxylate?
The IUPAC name of potassium methyl 2H-pyridin-2-ide-5-carboxylate (CID 174496363) is potassium methyl 2H-pyridin-2-ide-5-carboxylate.
What is the SMILES notation for potassium methyl 2H-pyridin-2-ide-5-carboxylate?
The canonical SMILES for potassium methyl 2H-pyridin-2-ide-5-carboxylate is COC(=O)c1cc[c-]nc1.[K+].
What is the InChIKey of potassium methyl 2H-pyridin-2-ide-5-carboxylate?
The InChIKey is JFSHJUMSXKKSQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6NO2.K/c1-10-7(9)6-3-2-4-8-5-6;/h2-3,5H,1H3;/q-1;+1.
What are the key properties of potassium methyl 2H-pyridin-2-ide-5-carboxylate?
potassium methyl 2H-pyridin-2-ide-5-carboxylate has a molecular weight of 175.23 g/mol, XLogP of -2.33, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium methyl 2H-pyridin-2-ide-5-carboxylate is sourced from PubChem (CID 174496363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).