C29H30ClFN2O — CID 174496635
1-[(1R)-1-(3-chloronaphthalen-1-yl)ethyl]-3-[4-(4-fluorophenyl)-1-methylpiperidin-4-yl]-2,5-dihydropyrrole-2-carbaldehyde (PubChem CID 174496635) has the molecular formula C29H30ClFN2O and a molecular weight of 477.02 g/mol. Its IUPAC name is 1-[(1R)-1-(3-chloronaphthalen-1-yl)ethyl]-3-[4-(4-fluorophenyl)-1-methylpiperidin-4-yl]-2,5-dihydropyrrole-2-carbaldehyde.
| Compound Name | 1-[(1R)-1-(3-chloronaphthalen-1-yl)ethyl]-3-[4-(4-fluorophenyl)-1-methylpiperidin-4-yl]-2,5-dihydropyrrole-2-carbaldehyde |
|---|---|
| PubChem CID | 174496635 |
| Molecular Formula | C29H30ClFN2O |
| Molecular Weight | 477.02 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | 1-[(1R)-1-(3-chloronaphthalen-1-yl)ethyl]-3-[4-(4-fluorophenyl)-1-methylpiperidin-4-yl]-2,5-dihydropyrrole-2-carbaldehyde |
| SMILES | C[C@H](c1cc(Cl)cc2ccccc12)N1CC=C(C2(c3ccc(F)cc3)CCN(C)CC2)C1C=O |
| InChI | InChI=1S/C29H30ClFN2O/c1-20(26-18-23(30)17-21-5-3-4-6-25(21)26)33-14-11-27(28(33)19-34)29(12-15-32(2)16-13-29)22-7-9-24(31)10-8-22/h3-11,17-20,28H,12-16H2,1-2H3/t20-,28?/m1/s1 |
| InChIKey | WBTMDGCECDBEBA-HFLPEKOISA-N |
| XLogP | 6.17 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.02 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|