About [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate
[1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate (PubChem CID 174496927) has the molecular formula C17H28N2O2
and a molecular weight of 292.42 g/mol. Its IUPAC name is [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate.
Molecular Properties
| Compound Name | [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate |
| PubChem CID | 174496927 |
| Molecular Formula | C17H28N2O2 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.22 |
| IUPAC Name | [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate |
| SMILES | CCN(CC)c1cc(C)c(CC(C)(C)OC(N)=O)cc1C |
| InChI | InChI=1S/C17H28N2O2/c1-7-19(8-2)15-10-12(3)14(9-13(15)4)11-17(5,6)21-16(18)20/h9-10H,7-8,11H2,1-6H3,(H2,18,20) |
| InChIKey | GCGUMHHNCIUJDD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate?
The IUPAC name of [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate (CID 174496927) is [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate.
What is the SMILES notation for [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate?
The canonical SMILES for [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate is CCN(CC)c1cc(C)c(CC(C)(C)OC(N)=O)cc1C.
What is the InChIKey of [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate?
The InChIKey is GCGUMHHNCIUJDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28N2O2/c1-7-19(8-2)15-10-12(3)14(9-13(15)4)11-17(5,6)21-16(18)20/h9-10H,7-8,11H2,1-6H3,(H2,18,20).
What are the key properties of [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate?
[1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate has a molecular weight of 292.42 g/mol, XLogP of 3.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[4-(diethylamino)-2,5-dimethylphenyl]-2-methylpropan-2-yl] carbamate is sourced from PubChem (CID 174496927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).