About bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide
bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide (PubChem CID 174497036) has the molecular formula C11H17NO
and a molecular weight of 179.26 g/mol. Its IUPAC name is bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide.
Molecular Properties
| Compound Name | bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide |
| PubChem CID | 174497036 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide |
| SMILES | C1=C2CCC(C1)C2.C=C(C)C(N)=O |
| InChI | InChI=1S/C7H10.C4H7NO/c1-2-7-4-3-6(1)5-7;1-3(2)4(5)6/h1,7H,2-5H2;1H2,2H3,(H2,5,6) |
| InChIKey | PIXOFKABQZJERK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide?
The IUPAC name of bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide (CID 174497036) is bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide.
What is the SMILES notation for bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide?
The canonical SMILES for bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide is C1=C2CCC(C1)C2.C=C(C)C(N)=O.
What is the InChIKey of bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide?
The InChIKey is PIXOFKABQZJERK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10.C4H7NO/c1-2-7-4-3-6(1)5-7;1-3(2)4(5)6/h1,7H,2-5H2;1H2,2H3,(H2,5,6).
What are the key properties of bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide?
bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide has a molecular weight of 179.26 g/mol, XLogP of 2.16, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.1]hept-1-ene;2-methylprop-2-enamide is sourced from PubChem (CID 174497036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).