C24H27N3O2 — CID 174497521
[5-(aminomethyl)-4-[4-(aminomethyl)phenyl]-6-(2-methylpropyl)-2-pyridinyl] benzoate (PubChem CID 174497521) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is [5-(aminomethyl)-4-[4-(aminomethyl)phenyl]-6-(2-methylpropyl)-2-pyridinyl] benzoate.
| Compound Name | [5-(aminomethyl)-4-[4-(aminomethyl)phenyl]-6-(2-methylpropyl)-2-pyridinyl] benzoate |
|---|---|
| PubChem CID | 174497521 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | [5-(aminomethyl)-4-[4-(aminomethyl)phenyl]-6-(2-methylpropyl)-2-pyridinyl] benzoate |
| SMILES | CC(C)Cc1nc(OC(=O)c2ccccc2)cc(-c2ccc(CN)cc2)c1CN |
| InChI | InChI=1S/C24H27N3O2/c1-16(2)12-22-21(15-26)20(18-10-8-17(14-25)9-11-18)13-23(27-22)29-24(28)19-6-4-3-5-7-19/h3-11,13,16H,12,14-15,25-26H2,1-2H3 |
| InChIKey | WOQQLIDVPSRVBO-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |