About 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate
1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate (PubChem CID 174498057) has the molecular formula C10H19N3O3
and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate.
Molecular Properties
| Compound Name | 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate |
| PubChem CID | 174498057 |
| Molecular Formula | C10H19N3O3 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate |
| SMILES | CC(=O)OC(C)C1CCN(C(N)=NO)CC1 |
| InChI | InChI=1S/C10H19N3O3/c1-7(16-8(2)14)9-3-5-13(6-4-9)10(11)12-15/h7,9,15H,3-6H2,1-2H3,(H2,11,12) |
| InChIKey | MIJAMWCKNORNID-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 88.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate?
The IUPAC name of 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate (CID 174498057) is 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate.
What is the SMILES notation for 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate?
The canonical SMILES for 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate is CC(=O)OC(C)C1CCN(C(N)=NO)CC1.
What is the InChIKey of 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate?
The InChIKey is MIJAMWCKNORNID-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O3/c1-7(16-8(2)14)9-3-5-13(6-4-9)10(11)12-15/h7,9,15H,3-6H2,1-2H3,(H2,11,12).
What are the key properties of 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate?
1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate has a molecular weight of 229.28 g/mol, XLogP of 0.35, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-(N'-hydroxycarbamimidoyl)piperidin-4-yl]ethyl acetate is sourced from PubChem (CID 174498057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).