C20H18F5N3S — CID 174498104
bicyclo[2.2.1]hepta-1,3,5-triene;4-[4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]-1,3-benzothiazole (PubChem CID 174498104) has the molecular formula C20H18F5N3S and a molecular weight of 427.44 g/mol. Its IUPAC name is bicyclo[2.2.1]hepta-1,3,5-triene;4-[4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]-1,3-benzothiazole.
| Compound Name | bicyclo[2.2.1]hepta-1,3,5-triene;4-[4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 174498104 |
| Molecular Formula | C20H18F5N3S |
| Molecular Weight | 427.44 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | bicyclo[2.2.1]hepta-1,3,5-triene;4-[4-(1,1,2,2,2-pentafluoroethyl)piperazin-1-yl]-1,3-benzothiazole |
| SMILES | C1=CC2=CC=C1C2.FC(F)(F)C(F)(F)N1CCN(c2cccc3scnc23)CC1 |
| InChI | InChI=1S/C13H12F5N3S.C7H6/c14-12(15,16)13(17,18)21-6-4-20(5-7-21)9-2-1-3-10-11(9)19-8-22-10;1-2-7-4-3-6(1)5-7/h1-3,8H,4-7H2;1-4H,5H2 |
| InChIKey | QLSCIRRMVUIPEX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.44 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|