About 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole
6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole (PubChem CID 174498431) has the molecular formula C18H17Cl2N3S
and a molecular weight of 378.33 g/mol. Its IUPAC name is 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole |
| PubChem CID | 174498431 |
| Molecular Formula | C18H17Cl2N3S |
| Molecular Weight | 378.33 g/mol |
| Exact Mass | 377.05 |
| IUPAC Name | 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole |
| SMILES | Clc1cccc(CN2CCN(c3ccc4ncsc4c3)CC2)c1Cl |
| InChI | InChI=1S/C18H17Cl2N3S/c19-15-3-1-2-13(18(15)20)11-22-6-8-23(9-7-22)14-4-5-16-17(10-14)24-12-21-16/h1-5,10,12H,6-9,11H2 |
| InChIKey | VXMIAQXQCZUZLJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.33 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole?
The IUPAC name of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole (CID 174498431) is 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole.
What is the SMILES notation for 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole?
The canonical SMILES for 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole is Clc1cccc(CN2CCN(c3ccc4ncsc4c3)CC2)c1Cl.
What is the InChIKey of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole?
The InChIKey is VXMIAQXQCZUZLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17Cl2N3S/c19-15-3-1-2-13(18(15)20)11-22-6-8-23(9-7-22)14-4-5-16-17(10-14)24-12-21-16/h1-5,10,12H,6-9,11H2.
What are the key properties of 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole?
6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole has a molecular weight of 378.33 g/mol, XLogP of 4.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[(2,3-dichlorophenyl)methyl]piperazin-1-yl]-1,3-benzothiazole is sourced from PubChem (CID 174498431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).