C24H19Cl3N2S — CID 174498476
5-phenyl-4-[4-(3,4,5-trichlorophenyl)piperidin-1-yl]-1,3-benzothiazole (PubChem CID 174498476) has the molecular formula C24H19Cl3N2S and a molecular weight of 473.86 g/mol. Its IUPAC name is 5-phenyl-4-[4-(3,4,5-trichlorophenyl)piperidin-1-yl]-1,3-benzothiazole.
| Compound Name | 5-phenyl-4-[4-(3,4,5-trichlorophenyl)piperidin-1-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 174498476 |
| Molecular Formula | C24H19Cl3N2S |
| Molecular Weight | 473.86 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 5-phenyl-4-[4-(3,4,5-trichlorophenyl)piperidin-1-yl]-1,3-benzothiazole |
| SMILES | Clc1cc(C2CCN(c3c(-c4ccccc4)ccc4scnc34)CC2)cc(Cl)c1Cl |
| InChI | InChI=1S/C24H19Cl3N2S/c25-19-12-17(13-20(26)22(19)27)15-8-10-29(11-9-15)24-18(16-4-2-1-3-5-16)6-7-21-23(24)28-14-30-21/h1-7,12-15H,8-11H2 |
| InChIKey | GNEXZQJNJNHFMI-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.86 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|