About 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde
2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde (PubChem CID 174498998) has the molecular formula C22H16Br2O
and a molecular weight of 456.18 g/mol. Its IUPAC name is 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde.
Molecular Properties
| Compound Name | 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde |
| PubChem CID | 174498998 |
| Molecular Formula | C22H16Br2O |
| Molecular Weight | 456.18 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde |
| SMILES | Cc1cc(-c2ccc3c(c2)C(C=O)c2cc(Br)ccc2-3)cc(C)c1Br |
| InChI | InChI=1S/C22H16Br2O/c1-12-7-15(8-13(2)22(12)24)14-3-5-17-18-6-4-16(23)10-20(18)21(11-25)19(17)9-14/h3-11,21H,1-2H3 |
| InChIKey | ZLIULYAENDSKNJ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.18 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde?
The IUPAC name of 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde (CID 174498998) is 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde.
What is the SMILES notation for 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde?
The canonical SMILES for 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde is Cc1cc(-c2ccc3c(c2)C(C=O)c2cc(Br)ccc2-3)cc(C)c1Br.
What is the InChIKey of 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde?
The InChIKey is ZLIULYAENDSKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H16Br2O/c1-12-7-15(8-13(2)22(12)24)14-3-5-17-18-6-4-16(23)10-20(18)21(11-25)19(17)9-14/h3-11,21H,1-2H3.
What are the key properties of 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde?
2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde has a molecular weight of 456.18 g/mol, XLogP of 6.81, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-7-(4-bromo-3,5-dimethylphenyl)-9H-fluorene-9-carbaldehyde is sourced from PubChem (CID 174498998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).