C22H42O6 — CID 174499300
ethane-1,2-diol;4-(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid (PubChem CID 174499300) has the molecular formula C22H42O6 and a molecular weight of 402.57 g/mol. Its IUPAC name is ethane-1,2-diol;4-(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid.
| Compound Name | ethane-1,2-diol;4-(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 174499300 |
| Molecular Formula | C22H42O6 |
| Molecular Weight | 402.57 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | ethane-1,2-diol;4-(10-methylundecoxycarbonyl)cyclohexane-1-carboxylic acid |
| SMILES | CC(C)CCCCCCCCCOC(=O)C1CCC(C(=O)O)CC1.OCCO |
| InChI | InChI=1S/C20H36O4.C2H6O2/c1-16(2)10-8-6-4-3-5-7-9-15-24-20(23)18-13-11-17(12-14-18)19(21)22;3-1-2-4/h16-18H,3-15H2,1-2H3,(H,21,22);3-4H,1-2H2 |
| InChIKey | KLDJIJVISWXRIE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.57 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|