About 1H-imidazole-2,5-diamine;triazine
1H-imidazole-2,5-diamine;triazine (PubChem CID 174499636) has the molecular formula C6H9N7
and a molecular weight of 179.19 g/mol. Its IUPAC name is 1H-imidazole-2,5-diamine;triazine.
Molecular Properties
| Compound Name | 1H-imidazole-2,5-diamine;triazine |
| PubChem CID | 174499636 |
| Molecular Formula | C6H9N7 |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1H-imidazole-2,5-diamine;triazine |
| SMILES | Nc1cnc(N)[nH]1.c1cnnnc1 |
| InChI | InChI=1S/C3H6N4.C3H3N3/c4-2-1-6-3(5)7-2;1-2-4-6-5-3-1/h1H,4H2,(H3,5,6,7);1-3H |
| InChIKey | APFWLILXPDNYPR-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1H-imidazole-2,5-diamine;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole-2,5-diamine;triazine?
The IUPAC name of 1H-imidazole-2,5-diamine;triazine (CID 174499636) is 1H-imidazole-2,5-diamine;triazine.
What is the SMILES notation for 1H-imidazole-2,5-diamine;triazine?
The canonical SMILES for 1H-imidazole-2,5-diamine;triazine is Nc1cnc(N)[nH]1.c1cnnnc1.
What is the InChIKey of 1H-imidazole-2,5-diamine;triazine?
The InChIKey is APFWLILXPDNYPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N4.C3H3N3/c4-2-1-6-3(5)7-2;1-2-4-6-5-3-1/h1H,4H2,(H3,5,6,7);1-3H.
What are the key properties of 1H-imidazole-2,5-diamine;triazine?
1H-imidazole-2,5-diamine;triazine has a molecular weight of 179.19 g/mol, XLogP of -0.55, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole-2,5-diamine;triazine is sourced from PubChem (CID 174499636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).