About 4-phenylpiperidine;sulfane;hydrochloride
4-phenylpiperidine;sulfane;hydrochloride (PubChem CID 174499697) has the molecular formula C11H18ClNS
and a molecular weight of 231.79 g/mol. Its IUPAC name is 4-phenylpiperidine;sulfane;hydrochloride.
Molecular Properties
| Compound Name | 4-phenylpiperidine;sulfane;hydrochloride |
| PubChem CID | 174499697 |
| Molecular Formula | C11H18ClNS |
| Molecular Weight | 231.79 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 4-phenylpiperidine;sulfane;hydrochloride |
| SMILES | Cl.S.c1ccc(C2CCNCC2)cc1 |
| InChI | InChI=1S/C11H15N.ClH.H2S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;;/h1-5,11-12H,6-9H2;1H;1H2 |
| InChIKey | UKYIIANGFXNSJC-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.79 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-phenylpiperidine;sulfane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylpiperidine;sulfane;hydrochloride?
The IUPAC name of 4-phenylpiperidine;sulfane;hydrochloride (CID 174499697) is 4-phenylpiperidine;sulfane;hydrochloride.
What is the SMILES notation for 4-phenylpiperidine;sulfane;hydrochloride?
The canonical SMILES for 4-phenylpiperidine;sulfane;hydrochloride is Cl.S.c1ccc(C2CCNCC2)cc1.
What is the InChIKey of 4-phenylpiperidine;sulfane;hydrochloride?
The InChIKey is UKYIIANGFXNSJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N.ClH.H2S/c1-2-4-10(5-3-1)11-6-8-12-9-7-11;;/h1-5,11-12H,6-9H2;1H;1H2.
What are the key properties of 4-phenylpiperidine;sulfane;hydrochloride?
4-phenylpiperidine;sulfane;hydrochloride has a molecular weight of 231.79 g/mol, XLogP of 2.69, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylpiperidine;sulfane;hydrochloride is sourced from PubChem (CID 174499697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).