C17H19N5OS2 — CID 17450006
N-[2-(N-methylanilino)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide (PubChem CID 17450006) has the molecular formula C17H19N5OS2 and a molecular weight of 373.51 g/mol. Its IUPAC name is N-[2-(N-methylanilino)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide.
| Compound Name | N-[2-(N-methylanilino)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
|---|---|
| PubChem CID | 17450006 |
| Molecular Formula | C17H19N5OS2 |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | N-[2-(N-methylanilino)ethyl]-2-(5-sulfanylidene-3-thiophen-2-yl-1H-1,2,4-triazol-4-yl)acetamide |
| SMILES | CN(CCNC(=O)Cn1c(-c2cccs2)n[nH]c1=S)c1ccccc1 |
| InChI | InChI=1S/C17H19N5OS2/c1-21(13-6-3-2-4-7-13)10-9-18-15(23)12-22-16(19-20-17(22)24)14-8-5-11-25-14/h2-8,11H,9-10,12H2,1H3,(H,18,23)(H,20,24) |
| InChIKey | DQURMRXTOSSUMX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 65.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|