C14H14O3S — CID 174500064
3-(3,5-dimethylphenyl)-4-hydroxybenzenesulfinic acid (PubChem CID 174500064) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-4-hydroxybenzenesulfinic acid.
| Compound Name | 3-(3,5-dimethylphenyl)-4-hydroxybenzenesulfinic acid |
|---|---|
| PubChem CID | 174500064 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-4-hydroxybenzenesulfinic acid |
| SMILES | Cc1cc(C)cc(-c2cc(S(=O)O)ccc2O)c1 |
| InChI | InChI=1S/C14H14O3S/c1-9-5-10(2)7-11(6-9)13-8-12(18(16)17)3-4-14(13)15/h3-8,15H,1-2H3,(H,16,17) |
| InChIKey | FZGVVRYEBJMAJU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|