About 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide
2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide (PubChem CID 174500581) has the molecular formula C23H19ClN2O
and a molecular weight of 374.87 g/mol. Its IUPAC name is 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide.
Molecular Properties
| Compound Name | 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide |
| PubChem CID | 174500581 |
| Molecular Formula | C23H19ClN2O |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide |
| SMILES | C=C(/C(N)=N/c1ccc(Cl)cc1)c1ccc(-c2ccccc2C(C)=O)cc1 |
| InChI | InChI=1S/C23H19ClN2O/c1-15(23(25)26-20-13-11-19(24)12-14-20)17-7-9-18(10-8-17)22-6-4-3-5-21(22)16(2)27/h3-14H,1H2,2H3,(H2,25,26) |
| InChIKey | RZBCDDZCGUNZPU-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide?
The IUPAC name of 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide (CID 174500581) is 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide.
What is the SMILES notation for 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide?
The canonical SMILES for 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide is C=C(/C(N)=N/c1ccc(Cl)cc1)c1ccc(-c2ccccc2C(C)=O)cc1.
What is the InChIKey of 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide?
The InChIKey is RZBCDDZCGUNZPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClN2O/c1-15(23(25)26-20-13-11-19(24)12-14-20)17-7-9-18(10-8-17)22-6-4-3-5-21(22)16(2)27/h3-14H,1H2,2H3,(H2,25,26).
What are the key properties of 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide?
2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide has a molecular weight of 374.87 g/mol, XLogP of 5.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2-acetylphenyl)phenyl]-N'-(4-chlorophenyl)prop-2-enimidamide is sourced from PubChem (CID 174500581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).