C10H18O6Si — CID 174500869
3-(1,1,2-trimethoxy-3-silylpropyl)oxolane-2,5-dione (PubChem CID 174500869) has the molecular formula C10H18O6Si and a molecular weight of 262.33 g/mol. Its IUPAC name is 3-(1,1,2-trimethoxy-3-silylpropyl)oxolane-2,5-dione.
| Compound Name | 3-(1,1,2-trimethoxy-3-silylpropyl)oxolane-2,5-dione |
|---|---|
| PubChem CID | 174500869 |
| Molecular Formula | C10H18O6Si |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-(1,1,2-trimethoxy-3-silylpropyl)oxolane-2,5-dione |
| SMILES | COC(C[SiH3])C(OC)(OC)C1CC(=O)OC1=O |
| InChI | InChI=1S/C10H18O6Si/c1-13-7(5-17)10(14-2,15-3)6-4-8(11)16-9(6)12/h6-7H,4-5H2,1-3,17H3 |
| InChIKey | JZGMRLINEQUQAF-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|