About azane;2,4-dipropylpyrimidine
azane;2,4-dipropylpyrimidine (PubChem CID 174500974) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is azane;2,4-dipropylpyrimidine.
Molecular Properties
| Compound Name | azane;2,4-dipropylpyrimidine |
| PubChem CID | 174500974 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | azane;2,4-dipropylpyrimidine |
| SMILES | CCCc1ccnc(CCC)n1.N |
| InChI | InChI=1S/C10H16N2.H3N/c1-3-5-9-7-8-11-10(12-9)6-4-2;/h7-8H,3-6H2,1-2H3;1H3 |
| InChIKey | UVAKEQQQTHNAMH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 60.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;2,4-dipropylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2,4-dipropylpyrimidine?
The IUPAC name of azane;2,4-dipropylpyrimidine (CID 174500974) is azane;2,4-dipropylpyrimidine.
What is the SMILES notation for azane;2,4-dipropylpyrimidine?
The canonical SMILES for azane;2,4-dipropylpyrimidine is CCCc1ccnc(CCC)n1.N.
What is the InChIKey of azane;2,4-dipropylpyrimidine?
The InChIKey is UVAKEQQQTHNAMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N2.H3N/c1-3-5-9-7-8-11-10(12-9)6-4-2;/h7-8H,3-6H2,1-2H3;1H3.
What are the key properties of azane;2,4-dipropylpyrimidine?
azane;2,4-dipropylpyrimidine has a molecular weight of 181.28 g/mol, XLogP of 2.54, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2,4-dipropylpyrimidine is sourced from PubChem (CID 174500974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).