About 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid
4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid (PubChem CID 174501383) has the molecular formula C22H30O5S
and a molecular weight of 406.54 g/mol. Its IUPAC name is 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid.
Molecular Properties
| Compound Name | 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid |
| PubChem CID | 174501383 |
| Molecular Formula | C22H30O5S |
| Molecular Weight | 406.54 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid |
| SMILES | C=CC(c1cc2c(cc1CCCCCC)CCC2=O)S(=O)(=O)CCCC(=O)O |
| InChI | InChI=1S/C22H30O5S/c1-3-5-6-7-9-16-14-17-11-12-20(23)18(17)15-19(16)21(4-2)28(26,27)13-8-10-22(24)25/h4,14-15,21H,2-3,5-13H2,1H3,(H,24,25) |
| InChIKey | XHSFHDWPMKGGJB-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.54 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid?
The IUPAC name of 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid (CID 174501383) is 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid.
What is the SMILES notation for 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid?
The canonical SMILES for 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid is C=CC(c1cc2c(cc1CCCCCC)CCC2=O)S(=O)(=O)CCCC(=O)O.
What is the InChIKey of 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid?
The InChIKey is XHSFHDWPMKGGJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H30O5S/c1-3-5-6-7-9-16-14-17-11-12-20(23)18(17)15-19(16)21(4-2)28(26,27)13-8-10-22(24)25/h4,14-15,21H,2-3,5-13H2,1H3,(H,24,25).
What are the key properties of 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid?
4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid has a molecular weight of 406.54 g/mol, XLogP of 4.45, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(6-hexyl-3-oxo-1,2-dihydroinden-5-yl)prop-2-enylsulfonyl]butanoic acid is sourced from PubChem (CID 174501383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).