About 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine
5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine (PubChem CID 174501433) has the molecular formula C10H20N6
and a molecular weight of 224.31 g/mol. Its IUPAC name is 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine.
Molecular Properties
| Compound Name | 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine |
| PubChem CID | 174501433 |
| Molecular Formula | C10H20N6 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine |
| SMILES | CCc1nc(C)cn1C1CN(N)CC(N)N1 |
| InChI | InChI=1S/C10H20N6/c1-3-9-13-7(2)4-16(9)10-6-15(12)5-8(11)14-10/h4,8,10,14H,3,5-6,11-12H2,1-2H3 |
| InChIKey | CNHXQOGUZZWACJ-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine?
The IUPAC name of 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine (CID 174501433) is 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine.
What is the SMILES notation for 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine?
The canonical SMILES for 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine is CCc1nc(C)cn1C1CN(N)CC(N)N1.
What is the InChIKey of 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine?
The InChIKey is CNHXQOGUZZWACJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N6/c1-3-9-13-7(2)4-16(9)10-6-15(12)5-8(11)14-10/h4,8,10,14H,3,5-6,11-12H2,1-2H3.
What are the key properties of 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine?
5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine has a molecular weight of 224.31 g/mol, XLogP of -0.68, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-ethyl-4-methylimidazol-1-yl)piperazine-1,3-diamine is sourced from PubChem (CID 174501433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).