About azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium
azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium (PubChem CID 174501538) has the molecular formula C8H20F3N2O4S+
and a molecular weight of 297.32 g/mol. Its IUPAC name is azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium.
Molecular Properties
| Compound Name | azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium |
| PubChem CID | 174501538 |
| Molecular Formula | C8H20F3N2O4S+ |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium |
| SMILES | COS(=O)(=O)C(F)(F)F.C[N+](C)(C)CC1CO1.N |
| InChI | InChI=1S/C6H14NO.C2H3F3O3S.H3N/c1-7(2,3)4-6-5-8-6;1-8-9(6,7)2(3,4)5;/h6H,4-5H2,1-3H3;1H3;1H3/q+1;; |
| InChIKey | CRSLVTKLEIRQSW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium?
The IUPAC name of azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium (CID 174501538) is azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium.
What is the SMILES notation for azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium?
The canonical SMILES for azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium is COS(=O)(=O)C(F)(F)F.C[N+](C)(C)CC1CO1.N.
What is the InChIKey of azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium?
The InChIKey is CRSLVTKLEIRQSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NO.C2H3F3O3S.H3N/c1-7(2,3)4-6-5-8-6;1-8-9(6,7)2(3,4)5;/h6H,4-5H2,1-3H3;1H3;1H3/q+1;;.
What are the key properties of azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium?
azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium has a molecular weight of 297.32 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl trifluoromethanesulfonate;trimethyl(oxiran-2-ylmethyl)azanium is sourced from PubChem (CID 174501538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).