C23H14N6O6 — CID 174502620
(2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone;naphthalene-1,2-dione (PubChem CID 174502620) has the molecular formula C23H14N6O6 and a molecular weight of 470.40 g/mol. Its IUPAC name is (2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone;naphthalene-1,2-dione.
| Compound Name | (2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone;naphthalene-1,2-dione |
|---|---|
| PubChem CID | 174502620 |
| Molecular Formula | C23H14N6O6 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 470.10 |
| IUPAC Name | (2,3-diazido-4,5,6-trihydroxyphenyl)-phenylmethanone;naphthalene-1,2-dione |
| SMILES | O=C1C=Cc2ccccc2C1=O.[N-]=[N+]=Nc1c(O)c(O)c(O)c(C(=O)c2ccccc2)c1N=[N+]=[N-] |
| InChI | InChI=1S/C13H8N6O4.C10H6O2/c14-18-16-8-7(10(20)6-4-2-1-3-5-6)11(21)13(23)12(22)9(8)17-19-15;11-9-6-5-7-3-1-2-4-8(7)10(9)12/h1-5,21-23H;1-6H |
| InChIKey | KCKGSUJXQAJBLV-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 209.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'} |
|---|