About methane;2,3,4,5-tetramethyl-1H-indole
methane;2,3,4,5-tetramethyl-1H-indole (PubChem CID 174502737) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is methane;2,3,4,5-tetramethyl-1H-indole.
Molecular Properties
| Compound Name | methane;2,3,4,5-tetramethyl-1H-indole |
| PubChem CID | 174502737 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | methane;2,3,4,5-tetramethyl-1H-indole |
| SMILES | C.Cc1ccc2[nH]c(C)c(C)c2c1C |
| InChI | InChI=1S/C12H15N.CH4/c1-7-5-6-11-12(8(7)2)9(3)10(4)13-11;/h5-6,13H,1-4H3;1H4 |
| InChIKey | CQIDQMQCKRRDNP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze methane;2,3,4,5-tetramethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2,3,4,5-tetramethyl-1H-indole?
The IUPAC name of methane;2,3,4,5-tetramethyl-1H-indole (CID 174502737) is methane;2,3,4,5-tetramethyl-1H-indole.
What is the SMILES notation for methane;2,3,4,5-tetramethyl-1H-indole?
The canonical SMILES for methane;2,3,4,5-tetramethyl-1H-indole is C.Cc1ccc2[nH]c(C)c(C)c2c1C.
What is the InChIKey of methane;2,3,4,5-tetramethyl-1H-indole?
The InChIKey is CQIDQMQCKRRDNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.CH4/c1-7-5-6-11-12(8(7)2)9(3)10(4)13-11;/h5-6,13H,1-4H3;1H4.
What are the key properties of methane;2,3,4,5-tetramethyl-1H-indole?
methane;2,3,4,5-tetramethyl-1H-indole has a molecular weight of 189.30 g/mol, XLogP of 4.04, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2,3,4,5-tetramethyl-1H-indole is sourced from PubChem (CID 174502737), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).