About 2-imino-3-methylbutane-1,4-diol
2-imino-3-methylbutane-1,4-diol (PubChem CID 174502948) has the molecular formula C5H11NO2
and a molecular weight of 117.15 g/mol. Its IUPAC name is 2-imino-3-methylbutane-1,4-diol.
Molecular Properties
| Compound Name | 2-imino-3-methylbutane-1,4-diol |
| PubChem CID | 174502948 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | 2-imino-3-methylbutane-1,4-diol |
| SMILES | [H]/N=C(\CO)C(C)CO |
| InChI | InChI=1S/C5H11NO2/c1-4(2-7)5(6)3-8/h4,6-8H,2-3H2,1H3/b6-5+ |
| InChIKey | HSIMJRNNKDMYGX-AATRIKPKSA-N |
| XLogP | -0.37 |
| TPSA | 64.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-imino-3-methylbutane-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imino-3-methylbutane-1,4-diol?
The IUPAC name of 2-imino-3-methylbutane-1,4-diol (CID 174502948) is 2-imino-3-methylbutane-1,4-diol.
What is the SMILES notation for 2-imino-3-methylbutane-1,4-diol?
The canonical SMILES for 2-imino-3-methylbutane-1,4-diol is [H]/N=C(\CO)C(C)CO.
What is the InChIKey of 2-imino-3-methylbutane-1,4-diol?
The InChIKey is HSIMJRNNKDMYGX-AATRIKPKSA-N. The full InChI is InChI=1S/C5H11NO2/c1-4(2-7)5(6)3-8/h4,6-8H,2-3H2,1H3/b6-5+.
What are the key properties of 2-imino-3-methylbutane-1,4-diol?
2-imino-3-methylbutane-1,4-diol has a molecular weight of 117.15 g/mol, XLogP of -0.37, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imino-3-methylbutane-1,4-diol is sourced from PubChem (CID 174502948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).