C27H35FN2O7 — CID 174503244
4-[[3-cyclopentyl-3-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoic acid (PubChem CID 174503244) has the molecular formula C27H35FN2O7 and a molecular weight of 518.58 g/mol. Its IUPAC name is 4-[[3-cyclopentyl-3-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoic acid.
| Compound Name | 4-[[3-cyclopentyl-3-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoic acid |
|---|---|
| PubChem CID | 174503244 |
| Molecular Formula | C27H35FN2O7 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 4-[[3-cyclopentyl-3-[[5-(3-fluorophenyl)furan-2-carbonyl]amino]propanoyl]amino]-4,4-diethoxybutanoic acid |
| SMILES | CCOC(CCC(=O)O)(NC(=O)CC(NC(=O)c1ccc(-c2cccc(F)c2)o1)C1CCCC1)OCC |
| InChI | InChI=1S/C27H35FN2O7/c1-3-35-27(36-4-2,15-14-25(32)33)30-24(31)17-21(18-8-5-6-9-18)29-26(34)23-13-12-22(37-23)19-10-7-11-20(28)16-19/h7,10-13,16,18,21H,3-6,8-9,14-15,17H2,1-2H3,(H,29,34)(H,30,31)(H,32,33) |
| InChIKey | ZTXZEJDOJOSDAO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 127.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|