C24H26F3N5O3S — CID 174503768
N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-4-iminohexanamide (PubChem CID 174503768) has the molecular formula C24H26F3N5O3S and a molecular weight of 521.57 g/mol. Its IUPAC name is N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-4-iminohexanamide.
| Compound Name | N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-4-iminohexanamide |
|---|---|
| PubChem CID | 174503768 |
| Molecular Formula | C24H26F3N5O3S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethylsulfanyl)phenyl]imidazolidin-1-yl]methyl]-2-pyridinyl]-4-iminohexanamide |
| SMILES | [H]/N=C(\CC)CCC(=O)Nc1cc(CN2C(=O)N(c3ccc(SC(F)(F)F)cc3)C(=O)C2(C)C)ccn1 |
| InChI | InChI=1S/C24H26F3N5O3S/c1-4-16(28)5-10-20(33)30-19-13-15(11-12-29-19)14-31-22(35)32(21(34)23(31,2)3)17-6-8-18(9-7-17)36-24(25,26)27/h6-9,11-13,28H,4-5,10,14H2,1-3H3,(H,29,30,33)/b28-16+ |
| InChIKey | NGMFZEXRYGFOMR-LQKURTRISA-N |
| XLogP | 5.59 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|