C27H28F3N5O3S — CID 174503775
N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethyl)thiophen-2-yl]imidazolidin-1-yl]methyl]-2-pyridinyl]-3-(2-phenylethylamino)propanamide (PubChem CID 174503775) has the molecular formula C27H28F3N5O3S and a molecular weight of 559.61 g/mol. Its IUPAC name is N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethyl)thiophen-2-yl]imidazolidin-1-yl]methyl]-2-pyridinyl]-3-(2-phenylethylamino)propanamide.
| Compound Name | N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethyl)thiophen-2-yl]imidazolidin-1-yl]methyl]-2-pyridinyl]-3-(2-phenylethylamino)propanamide |
|---|---|
| PubChem CID | 174503775 |
| Molecular Formula | C27H28F3N5O3S |
| Molecular Weight | 559.61 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | N-[4-[[5,5-dimethyl-2,4-dioxo-3-[4-(trifluoromethyl)thiophen-2-yl]imidazolidin-1-yl]methyl]-2-pyridinyl]-3-(2-phenylethylamino)propanamide |
| SMILES | CC1(C)C(=O)N(c2cc(C(F)(F)F)cs2)C(=O)N1Cc1ccnc(NC(=O)CCNCCc2ccccc2)c1 |
| InChI | InChI=1S/C27H28F3N5O3S/c1-26(2)24(37)35(23-15-20(17-39-23)27(28,29)30)25(38)34(26)16-19-9-13-32-21(14-19)33-22(36)10-12-31-11-8-18-6-4-3-5-7-18/h3-7,9,13-15,17,31H,8,10-12,16H2,1-2H3,(H,32,33,36) |
| InChIKey | RPYHTIACFLZPFB-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 94.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.61 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|