About CID 174505326
CID 174505326 (PubChem CID 174505326) has the molecular formula C6H7AlFN2
and a molecular weight of 153.12 g/mol.
Molecular Properties
| Compound Name | CID 174505326 |
| PubChem CID | 174505326 |
| Molecular Formula | C6H7AlFN2 |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.04 |
| IUPAC Name | — |
| SMILES | CCc1ncncc1F.[Al] |
| InChI | InChI=1S/C6H7FN2.Al/c1-2-6-5(7)3-8-4-9-6;/h3-4H,2H2,1H3; |
| InChIKey | GNOAMOOTHFHDOF-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 174505326 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 174505326?
The IUPAC name of CID 174505326 (CID 174505326) is not available.
What is the SMILES notation for CID 174505326?
The canonical SMILES for CID 174505326 is CCc1ncncc1F.[Al].
What is the InChIKey of CID 174505326?
The InChIKey is GNOAMOOTHFHDOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7FN2.Al/c1-2-6-5(7)3-8-4-9-6;/h3-4H,2H2,1H3;.
What are the key properties of CID 174505326?
CID 174505326 has a molecular weight of 153.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 174505326 is sourced from PubChem (CID 174505326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).