About 2-cycloheptyl-1H-azepine;hydron
2-cycloheptyl-1H-azepine;hydron (PubChem CID 174505513) has the molecular formula C13H20N+
and a molecular weight of 190.31 g/mol. Its IUPAC name is 2-cycloheptyl-1H-azepine;hydron.
Molecular Properties
| Compound Name | 2-cycloheptyl-1H-azepine;hydron |
| PubChem CID | 174505513 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | 2-cycloheptyl-1H-azepine;hydron |
| SMILES | C1=CC=C(C2CCCCCC2)NC=C1.[H+] |
| InChI | InChI=1S/C13H19N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h3,6-7,10-12,14H,1-2,4-5,8-9H2/p+1 |
| InChIKey | QNSWBOHYYSAXOS-UHFFFAOYSA-O |
| XLogP | 3.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cycloheptyl-1H-azepine;hydron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cycloheptyl-1H-azepine;hydron?
The IUPAC name of 2-cycloheptyl-1H-azepine;hydron (CID 174505513) is 2-cycloheptyl-1H-azepine;hydron.
What is the SMILES notation for 2-cycloheptyl-1H-azepine;hydron?
The canonical SMILES for 2-cycloheptyl-1H-azepine;hydron is C1=CC=C(C2CCCCCC2)NC=C1.[H+].
What is the InChIKey of 2-cycloheptyl-1H-azepine;hydron?
The InChIKey is QNSWBOHYYSAXOS-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H19N/c1-2-5-9-12(8-4-1)13-10-6-3-7-11-14-13/h3,6-7,10-12,14H,1-2,4-5,8-9H2/p+1.
What are the key properties of 2-cycloheptyl-1H-azepine;hydron?
2-cycloheptyl-1H-azepine;hydron has a molecular weight of 190.31 g/mol, XLogP of 3.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cycloheptyl-1H-azepine;hydron is sourced from PubChem (CID 174505513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).