About [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate
[2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate (PubChem CID 174505516) has the molecular formula C14H25NO3
and a molecular weight of 255.36 g/mol. Its IUPAC name is [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate |
| PubChem CID | 174505516 |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC(=O)C(C)(C)[C@H]1CCCCN1 |
| InChI | InChI=1S/C14H25NO3/c1-13(2,3)11(16)18-12(17)14(4,5)10-8-6-7-9-15-10/h10,15H,6-9H2,1-5H3/t10-/m1/s1 |
| InChIKey | DAFBPQQKSFQQLM-SNVBAGLBSA-N |
| XLogP | 2.27 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate?
The IUPAC name of [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate (CID 174505516) is [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate?
The canonical SMILES for [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)OC(=O)C(C)(C)[C@H]1CCCCN1.
What is the InChIKey of [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate?
The InChIKey is DAFBPQQKSFQQLM-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H25NO3/c1-13(2,3)11(16)18-12(17)14(4,5)10-8-6-7-9-15-10/h10,15H,6-9H2,1-5H3/t10-/m1/s1.
What are the key properties of [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate?
[2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate has a molecular weight of 255.36 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-2-[(2R)-piperidin-2-yl]propanoyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174505516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).