About 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid
1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid (PubChem CID 174505651) has the molecular formula C14H19F3N2O2
and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid.
Molecular Properties
| Compound Name | 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid |
| PubChem CID | 174505651 |
| Molecular Formula | C14H19F3N2O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid |
| SMILES | CN1CCNCC1.Cc1ccc(C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C9H7F3O2.C5H12N2/c1-5-2-3-6(8(13)14)4-7(5)9(10,11)12;1-7-4-2-6-3-5-7/h2-4H,1H3,(H,13,14);6H,2-5H2,1H3 |
| InChIKey | LGDSZYHHNSJQFX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid?
The IUPAC name of 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid (CID 174505651) is 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid.
What is the SMILES notation for 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid?
The canonical SMILES for 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid is CN1CCNCC1.Cc1ccc(C(=O)O)cc1C(F)(F)F.
What is the InChIKey of 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid?
The InChIKey is LGDSZYHHNSJQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O2.C5H12N2/c1-5-2-3-6(8(13)14)4-7(5)9(10,11)12;1-7-4-2-6-3-5-7/h2-4H,1H3,(H,13,14);6H,2-5H2,1H3.
What are the key properties of 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid?
1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid has a molecular weight of 304.31 g/mol, XLogP of 2.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperazine;4-methyl-3-(trifluoromethyl)benzoic acid is sourced from PubChem (CID 174505651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).