C25H20IN — CID 174505698
N-[4-(4-iodophenyl)phenyl]-4-methyl-N-phenylaniline (PubChem CID 174505698) has the molecular formula C25H20IN and a molecular weight of 461.35 g/mol. Its IUPAC name is N-[4-(4-iodophenyl)phenyl]-4-methyl-N-phenylaniline.
| Compound Name | N-[4-(4-iodophenyl)phenyl]-4-methyl-N-phenylaniline |
|---|---|
| PubChem CID | 174505698 |
| Molecular Formula | C25H20IN |
| Molecular Weight | 461.35 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | N-[4-(4-iodophenyl)phenyl]-4-methyl-N-phenylaniline |
| SMILES | Cc1ccc(N(c2ccccc2)c2ccc(-c3ccc(I)cc3)cc2)cc1 |
| InChI | InChI=1S/C25H20IN/c1-19-7-15-24(16-8-19)27(23-5-3-2-4-6-23)25-17-11-21(12-18-25)20-9-13-22(26)14-10-20/h2-18H,1H3 |
| InChIKey | XRRKQNTUJGQGRM-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.35 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|