C26H27NO4S — CID 174506700
tert-butyl (E)-3-[1-[1-(3-phenylphenyl)prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enoate (PubChem CID 174506700) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is tert-butyl (E)-3-[1-[1-(3-phenylphenyl)prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enoate.
| Compound Name | tert-butyl (E)-3-[1-[1-(3-phenylphenyl)prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 174506700 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | tert-butyl (E)-3-[1-[1-(3-phenylphenyl)prop-2-enylsulfonyl]pyrrol-3-yl]prop-2-enoate |
| SMILES | C=CC(c1cccc(-c2ccccc2)c1)S(=O)(=O)n1ccc(/C=C/C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C26H27NO4S/c1-5-24(23-13-9-12-22(18-23)21-10-7-6-8-11-21)32(29,30)27-17-16-20(19-27)14-15-25(28)31-26(2,3)4/h5-19,24H,1H2,2-4H3/b15-14+ |
| InChIKey | CMBNKNYEAGPRDU-CCEZHUSRSA-N |
| XLogP | 5.62 |
| TPSA | 65.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|