C14H22N2O6 — CID 174507153
1-O-tert-butyl 1-O,3-O-dimethyl 2-amino-3-cyano-1-methylpropane-1,1,3-tricarboxylate (PubChem CID 174507153) has the molecular formula C14H22N2O6 and a molecular weight of 314.34 g/mol. Its IUPAC name is 1-O-tert-butyl 1-O,3-O-dimethyl 2-amino-3-cyano-1-methylpropane-1,1,3-tricarboxylate.
| Compound Name | 1-O-tert-butyl 1-O,3-O-dimethyl 2-amino-3-cyano-1-methylpropane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 174507153 |
| Molecular Formula | C14H22N2O6 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 1-O-tert-butyl 1-O,3-O-dimethyl 2-amino-3-cyano-1-methylpropane-1,1,3-tricarboxylate |
| SMILES | COC(=O)C(C#N)C(N)C(C)(C(=O)OC)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H22N2O6/c1-13(2,3)22-12(19)14(4,11(18)21-6)9(16)8(7-15)10(17)20-5/h8-9H,16H2,1-6H3 |
| InChIKey | FOZXHFOSEUUFKA-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 128.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|