About 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform
2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform (PubChem CID 174507431) has the molecular formula C13H17F3OS
and a molecular weight of 278.34 g/mol. Its IUPAC name is 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform.
Molecular Properties
| Compound Name | 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform |
| PubChem CID | 174507431 |
| Molecular Formula | C13H17F3OS |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform |
| SMILES | Cc1cc(C2CCCS2)cc(C)c1O.FC(F)F |
| InChI | InChI=1S/C12H16OS.CHF3/c1-8-6-10(7-9(2)12(8)13)11-4-3-5-14-11;2-1(3)4/h6-7,11,13H,3-5H2,1-2H3;1H |
| InChIKey | RYWRLTHNLLFKSD-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform?
The IUPAC name of 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform (CID 174507431) is 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform.
What is the SMILES notation for 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform?
The canonical SMILES for 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform is Cc1cc(C2CCCS2)cc(C)c1O.FC(F)F.
What is the InChIKey of 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform?
The InChIKey is RYWRLTHNLLFKSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16OS.CHF3/c1-8-6-10(7-9(2)12(8)13)11-4-3-5-14-11;2-1(3)4/h6-7,11,13H,3-5H2,1-2H3;1H.
What are the key properties of 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform?
2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform has a molecular weight of 278.34 g/mol, XLogP of 4.76, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-4-(thiolan-2-yl)phenol;fluoroform is sourced from PubChem (CID 174507431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).