C15H13F2NO3 — CID 174507508
1,3-bis(4-fluorophenyl)propyl nitrate (PubChem CID 174507508) has the molecular formula C15H13F2NO3 and a molecular weight of 293.27 g/mol. Its IUPAC name is 1,3-bis(4-fluorophenyl)propyl nitrate.
| Compound Name | 1,3-bis(4-fluorophenyl)propyl nitrate |
|---|---|
| PubChem CID | 174507508 |
| Molecular Formula | C15H13F2NO3 |
| Molecular Weight | 293.27 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 1,3-bis(4-fluorophenyl)propyl nitrate |
| SMILES | O=[N+]([O-])OC(CCc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13F2NO3/c16-13-6-1-11(2-7-13)3-10-15(21-18(19)20)12-4-8-14(17)9-5-12/h1-2,4-9,15H,3,10H2 |
| InChIKey | GHCKKJQTQWOXCG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|