About 1,3-diethyl-2H-imidazole;fluoroform
1,3-diethyl-2H-imidazole;fluoroform (PubChem CID 174507741) has the molecular formula C8H15F3N2
and a molecular weight of 196.22 g/mol. Its IUPAC name is 1,3-diethyl-2H-imidazole;fluoroform.
Molecular Properties
| Compound Name | 1,3-diethyl-2H-imidazole;fluoroform |
| PubChem CID | 174507741 |
| Molecular Formula | C8H15F3N2 |
| Molecular Weight | 196.22 g/mol |
| Exact Mass | 196.12 |
| IUPAC Name | 1,3-diethyl-2H-imidazole;fluoroform |
| SMILES | CCN1C=CN(CC)C1.FC(F)F |
| InChI | InChI=1S/C7H14N2.CHF3/c1-3-8-5-6-9(4-2)7-8;2-1(3)4/h5-6H,3-4,7H2,1-2H3;1H |
| InChIKey | QEYDWEWSPTUISS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.22 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,3-diethyl-2H-imidazole;fluoroform with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-2H-imidazole;fluoroform?
The IUPAC name of 1,3-diethyl-2H-imidazole;fluoroform (CID 174507741) is 1,3-diethyl-2H-imidazole;fluoroform.
What is the SMILES notation for 1,3-diethyl-2H-imidazole;fluoroform?
The canonical SMILES for 1,3-diethyl-2H-imidazole;fluoroform is CCN1C=CN(CC)C1.FC(F)F.
What is the InChIKey of 1,3-diethyl-2H-imidazole;fluoroform?
The InChIKey is QEYDWEWSPTUISS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.CHF3/c1-3-8-5-6-9(4-2)7-8;2-1(3)4/h5-6H,3-4,7H2,1-2H3;1H.
What are the key properties of 1,3-diethyl-2H-imidazole;fluoroform?
1,3-diethyl-2H-imidazole;fluoroform has a molecular weight of 196.22 g/mol, XLogP of 2.25, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-2H-imidazole;fluoroform is sourced from PubChem (CID 174507741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).