About 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol
4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol (PubChem CID 174508220) has the molecular formula C22H27N5OS
and a molecular weight of 409.56 g/mol. Its IUPAC name is 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol.
Molecular Properties
| Compound Name | 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol |
| PubChem CID | 174508220 |
| Molecular Formula | C22H27N5OS |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol |
| SMILES | CN(C)C1CCN(c2ccc(Nc3nc(N)c(-c4ccc(O)cc4)s3)cc2)CC1 |
| InChI | InChI=1S/C22H27N5OS/c1-26(2)17-11-13-27(14-12-17)18-7-5-16(6-8-18)24-22-25-21(23)20(29-22)15-3-9-19(28)10-4-15/h3-10,17,28H,11-14,23H2,1-2H3,(H,24,25) |
| InChIKey | PWBVCKUXHWKVHE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 77.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|
Analyze 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol?
The IUPAC name of 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol (CID 174508220) is 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol.
What is the SMILES notation for 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol?
The canonical SMILES for 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol is CN(C)C1CCN(c2ccc(Nc3nc(N)c(-c4ccc(O)cc4)s3)cc2)CC1.
What is the InChIKey of 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol?
The InChIKey is PWBVCKUXHWKVHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27N5OS/c1-26(2)17-11-13-27(14-12-17)18-7-5-16(6-8-18)24-22-25-21(23)20(29-22)15-3-9-19(28)10-4-15/h3-10,17,28H,11-14,23H2,1-2H3,(H,24,25).
What are the key properties of 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol?
4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol has a molecular weight of 409.56 g/mol, XLogP of 4.37, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-amino-2-[4-[4-(dimethylamino)piperidin-1-yl]anilino]-1,3-thiazol-5-yl]phenol is sourced from PubChem (CID 174508220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).