About 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate
3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate (PubChem CID 174508223) has the molecular formula C18H27F3O7
and a molecular weight of 412.40 g/mol. Its IUPAC name is 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate.
Molecular Properties
| Compound Name | 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate |
| PubChem CID | 174508223 |
| Molecular Formula | C18H27F3O7 |
| Molecular Weight | 412.40 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)O.C=CC(=O)OC(F)(F)F.C=CC(CCC)CC(=O)O |
| InChI | InChI=1S/C8H14O2.C6H10O3.C4H3F3O2/c1-3-5-7(4-2)6-8(9)10;1-4(2)6(8)9-5(3)7;1-2-3(8)9-4(5,6)7/h4,7H,2-3,5-6H2,1H3,(H,9,10);5,7H,1H2,2-3H3;2H,1H2 |
| InChIKey | CTPIHUCLJNXFTD-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate?
The IUPAC name of 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate (CID 174508223) is 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate.
What is the SMILES notation for 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate?
The canonical SMILES for 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate is C=C(C)C(=O)OC(C)O.C=CC(=O)OC(F)(F)F.C=CC(CCC)CC(=O)O.
What is the InChIKey of 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate?
The InChIKey is CTPIHUCLJNXFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2.C6H10O3.C4H3F3O2/c1-3-5-7(4-2)6-8(9)10;1-4(2)6(8)9-5(3)7;1-2-3(8)9-4(5,6)7/h4,7H,2-3,5-6H2,1H3,(H,9,10);5,7H,1H2,2-3H3;2H,1H2.
What are the key properties of 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate?
3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate has a molecular weight of 412.40 g/mol, XLogP of 3.74, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenylhexanoic acid;1-hydroxyethyl 2-methylprop-2-enoate;trifluoromethyl prop-2-enoate is sourced from PubChem (CID 174508223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).