About [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine
[3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine (PubChem CID 174508897) has the molecular formula C12H10ClN3S
and a molecular weight of 263.75 g/mol. Its IUPAC name is [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine |
| PubChem CID | 174508897 |
| Molecular Formula | C12H10ClN3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine |
| SMILES | NCc1cccc(Cl)c1-c1nc2cscc2[nH]1 |
| InChI | InChI=1S/C12H10ClN3S/c13-8-3-1-2-7(4-14)11(8)12-15-9-5-17-6-10(9)16-12/h1-3,5-6H,4,14H2,(H,15,16) |
| InChIKey | FYKIYAXDHRRDMY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine?
The IUPAC name of [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine (CID 174508897) is [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine.
What is the SMILES notation for [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine?
The canonical SMILES for [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine is NCc1cccc(Cl)c1-c1nc2cscc2[nH]1.
What is the InChIKey of [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine?
The InChIKey is FYKIYAXDHRRDMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10ClN3S/c13-8-3-1-2-7(4-14)11(8)12-15-9-5-17-6-10(9)16-12/h1-3,5-6H,4,14H2,(H,15,16).
What are the key properties of [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine?
[3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine has a molecular weight of 263.75 g/mol, XLogP of 3.40, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-chloro-2-(1H-thieno[3,4-d]imidazol-2-yl)phenyl]methanamine is sourced from PubChem (CID 174508897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).