About 2-decyl-4-ethylpyridine;tetradecane
2-decyl-4-ethylpyridine;tetradecane (PubChem CID 174509045) has the molecular formula C31H59N
and a molecular weight of 445.82 g/mol. Its IUPAC name is 2-decyl-4-ethylpyridine;tetradecane.
Molecular Properties
| Compound Name | 2-decyl-4-ethylpyridine;tetradecane |
| PubChem CID | 174509045 |
| Molecular Formula | C31H59N |
| Molecular Weight | 445.82 g/mol |
| Exact Mass | 445.46 |
| IUPAC Name | 2-decyl-4-ethylpyridine;tetradecane |
| SMILES | CCCCCCCCCCCCCC.CCCCCCCCCCc1cc(CC)ccn1 |
| InChI | InChI=1S/C17H29N.C14H30/c1-3-5-6-7-8-9-10-11-12-17-15-16(4-2)13-14-18-17;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h13-15H,3-12H2,1-2H3;3-14H2,1-2H3 |
| InChIKey | SOMYDYJMTHIHCT-UHFFFAOYSA-N |
| XLogP | 11.03 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.82 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-decyl-4-ethylpyridine;tetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decyl-4-ethylpyridine;tetradecane?
The IUPAC name of 2-decyl-4-ethylpyridine;tetradecane (CID 174509045) is 2-decyl-4-ethylpyridine;tetradecane.
What is the SMILES notation for 2-decyl-4-ethylpyridine;tetradecane?
The canonical SMILES for 2-decyl-4-ethylpyridine;tetradecane is CCCCCCCCCCCCCC.CCCCCCCCCCc1cc(CC)ccn1.
What is the InChIKey of 2-decyl-4-ethylpyridine;tetradecane?
The InChIKey is SOMYDYJMTHIHCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N.C14H30/c1-3-5-6-7-8-9-10-11-12-17-15-16(4-2)13-14-18-17;1-3-5-7-9-11-13-14-12-10-8-6-4-2/h13-15H,3-12H2,1-2H3;3-14H2,1-2H3.
What are the key properties of 2-decyl-4-ethylpyridine;tetradecane?
2-decyl-4-ethylpyridine;tetradecane has a molecular weight of 445.82 g/mol, XLogP of 11.03, 21 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decyl-4-ethylpyridine;tetradecane is sourced from PubChem (CID 174509045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).