C7H10N4O4 — CID 174509093
3-(2,4,6-trioxo-1,3-diazinan-1-yl)propanehydrazide (PubChem CID 174509093) has the molecular formula C7H10N4O4 and a molecular weight of 214.18 g/mol. Its IUPAC name is 3-(2,4,6-trioxo-1,3-diazinan-1-yl)propanehydrazide.
| Compound Name | 3-(2,4,6-trioxo-1,3-diazinan-1-yl)propanehydrazide |
|---|---|
| PubChem CID | 174509093 |
| Molecular Formula | C7H10N4O4 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.07 |
| IUPAC Name | 3-(2,4,6-trioxo-1,3-diazinan-1-yl)propanehydrazide |
| SMILES | NNC(=O)CCN1C(=O)CC(=O)NC1=O |
| InChI | InChI=1S/C7H10N4O4/c8-10-4(12)1-2-11-6(14)3-5(13)9-7(11)15/h1-3,8H2,(H,10,12)(H,9,13,15) |
| InChIKey | NKQBRXJCIGOPSC-UHFFFAOYSA-N |
| XLogP | -2.17 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|