About [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate
[4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate (PubChem CID 174511222) has the molecular formula C13H26N2O3
and a molecular weight of 258.36 g/mol. Its IUPAC name is [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate.
Molecular Properties
| Compound Name | [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate |
| PubChem CID | 174511222 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate |
| SMILES | CC(CC1CC(CO)CCN1)C(C)(C)OC(N)=O |
| InChI | InChI=1S/C13H26N2O3/c1-9(13(2,3)18-12(14)17)6-11-7-10(8-16)4-5-15-11/h9-11,15-16H,4-8H2,1-3H3,(H2,14,17) |
| InChIKey | OLDZISFQXMAWFK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate?
The IUPAC name of [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate (CID 174511222) is [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate.
What is the SMILES notation for [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate?
The canonical SMILES for [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate is CC(CC1CC(CO)CCN1)C(C)(C)OC(N)=O.
What is the InChIKey of [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate?
The InChIKey is OLDZISFQXMAWFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N2O3/c1-9(13(2,3)18-12(14)17)6-11-7-10(8-16)4-5-15-11/h9-11,15-16H,4-8H2,1-3H3,(H2,14,17).
What are the key properties of [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate?
[4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate has a molecular weight of 258.36 g/mol, XLogP of 1.25, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-(hydroxymethyl)piperidin-2-yl]-2,3-dimethylbutan-2-yl] carbamate is sourced from PubChem (CID 174511222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).