About 2-(azidomethyl)-2,3-dihydronaphthalene
2-(azidomethyl)-2,3-dihydronaphthalene (PubChem CID 174511419) has the molecular formula C11H11N3
and a molecular weight of 185.23 g/mol. Its IUPAC name is 2-(azidomethyl)-2,3-dihydronaphthalene.
Molecular Properties
| Compound Name | 2-(azidomethyl)-2,3-dihydronaphthalene |
| PubChem CID | 174511419 |
| Molecular Formula | C11H11N3 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | 2-(azidomethyl)-2,3-dihydronaphthalene |
| SMILES | [N-]=[N+]=NCC1C=c2ccccc2=CC1 |
| InChI | InChI=1S/C11H11N3/c12-14-13-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-4,6-7,9H,5,8H2 |
| InChIKey | OEACLDBUHCFPNA-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(azidomethyl)-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azidomethyl)-2,3-dihydronaphthalene?
The IUPAC name of 2-(azidomethyl)-2,3-dihydronaphthalene (CID 174511419) is 2-(azidomethyl)-2,3-dihydronaphthalene.
What is the SMILES notation for 2-(azidomethyl)-2,3-dihydronaphthalene?
The canonical SMILES for 2-(azidomethyl)-2,3-dihydronaphthalene is [N-]=[N+]=NCC1C=c2ccccc2=CC1.
What is the InChIKey of 2-(azidomethyl)-2,3-dihydronaphthalene?
The InChIKey is OEACLDBUHCFPNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3/c12-14-13-8-9-5-6-10-3-1-2-4-11(10)7-9/h1-4,6-7,9H,5,8H2.
What are the key properties of 2-(azidomethyl)-2,3-dihydronaphthalene?
2-(azidomethyl)-2,3-dihydronaphthalene has a molecular weight of 185.23 g/mol, XLogP of 1.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azidomethyl)-2,3-dihydronaphthalene is sourced from PubChem (CID 174511419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).